C18H15NO5 — CID 7488457
[2-(2,5-dimethoxyphenyl)-2-oxoethyl] 3-cyanobenzoate (PubChem CID 7488457) has the molecular formula C18H15NO5 and a molecular weight of 325.32 g/mol. Its IUPAC name is [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 3-cyanobenzoate.
| Compound Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 3-cyanobenzoate |
|---|---|
| PubChem CID | 7488457 |
| Molecular Formula | C18H15NO5 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 3-cyanobenzoate |
| SMILES | COc1ccc(OC)c(C(=O)COC(=O)c2cccc(C#N)c2)c1 |
| InChI | InChI=1S/C18H15NO5/c1-22-14-6-7-17(23-2)15(9-14)16(20)11-24-18(21)13-5-3-4-12(8-13)10-19/h3-9H,11H2,1-2H3 |
| InChIKey | BUDNLCRLSLNXHC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |