C19H20O7 — CID 2431484
[2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2,6-dimethoxybenzoate (PubChem CID 2431484) has the molecular formula C19H20O7 and a molecular weight of 360.36 g/mol. Its IUPAC name is [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2,6-dimethoxybenzoate.
| Compound Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2,6-dimethoxybenzoate |
|---|---|
| PubChem CID | 2431484 |
| Molecular Formula | C19H20O7 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2,6-dimethoxybenzoate |
| SMILES | COc1ccc(OC)c(C(=O)COC(=O)c2c(OC)cccc2OC)c1 |
| InChI | InChI=1S/C19H20O7/c1-22-12-8-9-15(23-2)13(10-12)14(20)11-26-19(21)18-16(24-3)6-5-7-17(18)25-4/h5-10H,11H2,1-4H3 |
| InChIKey | DJMHVBGXTNGAOA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |