C17H15ClO5 — CID 2096696
[2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-chlorobenzoate (PubChem CID 2096696) has the molecular formula C17H15ClO5 and a molecular weight of 334.76 g/mol. Its IUPAC name is [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-chlorobenzoate.
| Compound Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 2096696 |
| Molecular Formula | C17H15ClO5 |
| Molecular Weight | 334.76 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-chlorobenzoate |
| SMILES | COc1ccc(OC)c(C(=O)COC(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C17H15ClO5/c1-21-11-7-8-16(22-2)13(9-11)15(19)10-23-17(20)12-5-3-4-6-14(12)18/h3-9H,10H2,1-2H3 |
| InChIKey | RFJXURVQZPSNTN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.76 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |