C18H18ClNO6 — CID 7875123
[2-(2,5-dimethoxyphenyl)-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate (PubChem CID 7875123) has the molecular formula C18H18ClNO6 and a molecular weight of 379.80 g/mol. Its IUPAC name is [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate.
| Compound Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 7875123 |
| Molecular Formula | C18H18ClNO6 |
| Molecular Weight | 379.80 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate |
| SMILES | COc1ccc(OC)c(C(=O)COC(=O)c2cc(Cl)c(N)cc2OC)c1 |
| InChI | InChI=1S/C18H18ClNO6/c1-23-10-4-5-16(24-2)11(6-10)15(21)9-26-18(22)12-7-13(19)14(20)8-17(12)25-3/h4-8H,9,20H2,1-3H3 |
| InChIKey | DBTZNONAWCACOA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.80 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|