C15H14O6 — CID 2456748
[2-(2,5-dimethoxyphenyl)-2-oxoethyl] furan-2-carboxylate (PubChem CID 2456748) has the molecular formula C15H14O6 and a molecular weight of 290.27 g/mol. Its IUPAC name is [2-(2,5-dimethoxyphenyl)-2-oxoethyl] furan-2-carboxylate.
| Compound Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 2456748 |
| Molecular Formula | C15H14O6 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] furan-2-carboxylate |
| SMILES | COc1ccc(OC)c(C(=O)COC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C15H14O6/c1-18-10-5-6-13(19-2)11(8-10)12(16)9-21-15(17)14-4-3-7-20-14/h3-8H,9H2,1-2H3 |
| InChIKey | RNCOMHJFSDVBFT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |