C11H13NO5 — CID 119090108
[2-(2,5-dimethoxyphenyl)-2-oxoethyl] carbamate (PubChem CID 119090108) has the molecular formula C11H13NO5 and a molecular weight of 239.23 g/mol. Its IUPAC name is [2-(2,5-dimethoxyphenyl)-2-oxoethyl] carbamate.
| Compound Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] carbamate |
|---|---|
| PubChem CID | 119090108 |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] carbamate |
| SMILES | COc1ccc(OC)c(C(=O)COC(N)=O)c1 |
| InChI | InChI=1S/C11H13NO5/c1-15-7-3-4-10(16-2)8(5-7)9(13)6-17-11(12)14/h3-5H,6H2,1-2H3,(H2,12,14) |
| InChIKey | BDKGGBUIDDQRBX-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |