C20H22O8 — CID 7628154
[2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2,4,5-trimethoxybenzoate (PubChem CID 7628154) has the molecular formula C20H22O8 and a molecular weight of 390.39 g/mol. Its IUPAC name is [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2,4,5-trimethoxybenzoate.
| Compound Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 7628154 |
| Molecular Formula | C20H22O8 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2,4,5-trimethoxybenzoate |
| SMILES | COc1ccc(OC)c(C(=O)COC(=O)c2cc(OC)c(OC)cc2OC)c1 |
| InChI | InChI=1S/C20H22O8/c1-23-12-6-7-16(24-2)13(8-12)15(21)11-28-20(22)14-9-18(26-4)19(27-5)10-17(14)25-3/h6-10H,11H2,1-5H3 |
| InChIKey | FAQUGBZWLXORLE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |