C17H14Cl2O5 — CID 7887065
[2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2,4-dichlorobenzoate (PubChem CID 7887065) has the molecular formula C17H14Cl2O5 and a molecular weight of 369.20 g/mol. Its IUPAC name is [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2,4-dichlorobenzoate.
| Compound Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 7887065 |
| Molecular Formula | C17H14Cl2O5 |
| Molecular Weight | 369.20 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2,4-dichlorobenzoate |
| SMILES | COc1ccc(OC)c(C(=O)COC(=O)c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C17H14Cl2O5/c1-22-11-4-6-16(23-2)13(8-11)15(20)9-24-17(21)12-5-3-10(18)7-14(12)19/h3-8H,9H2,1-2H3 |
| InChIKey | PSTCUGWTQWJQAW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.20 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |