C14H9Cl3O2 — CID 63492522
(5-chloro-2-methoxyphenyl)-(2,4-dichlorophenyl)methanone (PubChem CID 63492522) has the molecular formula C14H9Cl3O2 and a molecular weight of 315.58 g/mol. Its IUPAC name is (5-chloro-2-methoxyphenyl)-(2,4-dichlorophenyl)methanone.
| Compound Name | (5-chloro-2-methoxyphenyl)-(2,4-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 63492522 |
| Molecular Formula | C14H9Cl3O2 |
| Molecular Weight | 315.58 g/mol |
| Exact Mass | 313.97 |
| IUPAC Name | (5-chloro-2-methoxyphenyl)-(2,4-dichlorophenyl)methanone |
| SMILES | COc1ccc(Cl)cc1C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H9Cl3O2/c1-19-13-5-3-8(15)6-11(13)14(18)10-4-2-9(16)7-12(10)17/h2-7H,1H3 |
| InChIKey | QXJDLCJVSQNFTE-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.58 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |