C8H6ClO3- — CID 6933314
5-chloro-2-methoxybenzoate (PubChem CID 6933314) has the molecular formula C8H6ClO3- and a molecular weight of 185.59 g/mol. Its IUPAC name is 5-chloro-2-methoxybenzoate.
| Compound Name | 5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 6933314 |
| Molecular Formula | C8H6ClO3- |
| Molecular Weight | 185.59 g/mol |
| Exact Mass | 185.00 |
| IUPAC Name | 5-chloro-2-methoxybenzoate |
| SMILES | COc1ccc(Cl)cc1C(=O)[O-] |
| InChI | InChI=1S/C8H7ClO3/c1-12-7-3-2-5(9)4-6(7)8(10)11/h2-4H,1H3,(H,10,11)/p-1 |
| InChIKey | HULDRQRKKXRXBI-UHFFFAOYSA-M |
| XLogP | 0.71 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.59 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |