C10H8BrClO3 — CID 82134939
3-bromo-1-(5-chloro-2-methoxyphenyl)propane-1,2-dione (PubChem CID 82134939) has the molecular formula C10H8BrClO3 and a molecular weight of 291.53 g/mol. Its IUPAC name is 3-bromo-1-(5-chloro-2-methoxyphenyl)propane-1,2-dione.
| Compound Name | 3-bromo-1-(5-chloro-2-methoxyphenyl)propane-1,2-dione |
|---|---|
| PubChem CID | 82134939 |
| Molecular Formula | C10H8BrClO3 |
| Molecular Weight | 291.53 g/mol |
| Exact Mass | 289.93 |
| IUPAC Name | 3-bromo-1-(5-chloro-2-methoxyphenyl)propane-1,2-dione |
| SMILES | COc1ccc(Cl)cc1C(=O)C(=O)CBr |
| InChI | InChI=1S/C10H8BrClO3/c1-15-9-3-2-6(12)4-7(9)10(14)8(13)5-11/h2-4H,5H2,1H3 |
| InChIKey | DLVNCSLWPHEWRE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.53 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|