C13H6Cl4O — CID 43344575
(2,4-dichlorophenyl)-(2,5-dichlorophenyl)methanone (PubChem CID 43344575) has the molecular formula C13H6Cl4O and a molecular weight of 320.00 g/mol. Its IUPAC name is (2,4-dichlorophenyl)-(2,5-dichlorophenyl)methanone.
| Compound Name | (2,4-dichlorophenyl)-(2,5-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 43344575 |
| Molecular Formula | C13H6Cl4O |
| Molecular Weight | 320.00 g/mol |
| Exact Mass | 317.92 |
| IUPAC Name | (2,4-dichlorophenyl)-(2,5-dichlorophenyl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1Cl)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H6Cl4O/c14-7-2-4-11(16)10(5-7)13(18)9-3-1-8(15)6-12(9)17/h1-6H |
| InChIKey | TZBNLXIXLJLJGI-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.00 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |