C8H6Cl2O — CID 10750217
1-(2,4-dichlorophenyl)(214C)ethanone (PubChem CID 10750217) has the molecular formula C8H6Cl2O and a molecular weight of 191.03 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)(214C)ethanone.
| Compound Name | 1-(2,4-dichlorophenyl)(214C)ethanone |
|---|---|
| PubChem CID | 10750217 |
| Molecular Formula | C8H6Cl2O |
| Molecular Weight | 191.03 g/mol |
| Exact Mass | 189.98 |
| IUPAC Name | 1-(2,4-dichlorophenyl)(214C)ethanone |
| SMILES | [14CH3]C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H6Cl2O/c1-5(11)7-3-2-6(9)4-8(7)10/h2-4H,1H3/i1+2 |
| InChIKey | XMCRWEBERCXJCH-NJFSPNSNSA-N |
| XLogP | 3.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.03 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |