C10H8Cl2O3 — CID 116918261
3-(2,4-dichlorophenyl)-2-methyl-3-oxopropanoic acid (PubChem CID 116918261) has the molecular formula C10H8Cl2O3 and a molecular weight of 247.08 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-(2,4-dichlorophenyl)-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 116918261 |
| Molecular Formula | C10H8Cl2O3 |
| Molecular Weight | 247.08 g/mol |
| Exact Mass | 245.99 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-2-methyl-3-oxopropanoic acid |
| SMILES | CC(C(=O)O)C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H8Cl2O3/c1-5(10(14)15)9(13)7-3-2-6(11)4-8(7)12/h2-5H,1H3,(H,14,15) |
| InChIKey | ZNZPEFJEROIFDH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.08 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|