C25H26Cl4O3 — CID 139770202
2,4-ditert-butyl-1,5-bis(2,4-dichlorophenyl)pentane-1,3,5-trione (PubChem CID 139770202) has the molecular formula C25H26Cl4O3 and a molecular weight of 516.29 g/mol. Its IUPAC name is 2,4-ditert-butyl-1,5-bis(2,4-dichlorophenyl)pentane-1,3,5-trione.
| Compound Name | 2,4-ditert-butyl-1,5-bis(2,4-dichlorophenyl)pentane-1,3,5-trione |
|---|---|
| PubChem CID | 139770202 |
| Molecular Formula | C25H26Cl4O3 |
| Molecular Weight | 516.29 g/mol |
| Exact Mass | 514.06 |
| IUPAC Name | 2,4-ditert-butyl-1,5-bis(2,4-dichlorophenyl)pentane-1,3,5-trione |
| SMILES | CC(C)(C)C(C(=O)c1ccc(Cl)cc1Cl)C(=O)C(C(=O)c1ccc(Cl)cc1Cl)C(C)(C)C |
| InChI | InChI=1S/C25H26Cl4O3/c1-24(2,3)19(21(30)15-9-7-13(26)11-17(15)28)23(32)20(25(4,5)6)22(31)16-10-8-14(27)12-18(16)29/h7-12,19-20H,1-6H3 |
| InChIKey | WQSJJHLKGTZQCR-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.29 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|