C9H7Cl2IO2 — CID 70254435
1-(2,4-dichlorophenyl)-2-hydroxy-2-iodopropan-1-one (PubChem CID 70254435) has the molecular formula C9H7Cl2IO2 and a molecular weight of 344.96 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2-hydroxy-2-iodopropan-1-one.
| Compound Name | 1-(2,4-dichlorophenyl)-2-hydroxy-2-iodopropan-1-one |
|---|---|
| PubChem CID | 70254435 |
| Molecular Formula | C9H7Cl2IO2 |
| Molecular Weight | 344.96 g/mol |
| Exact Mass | 343.89 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2-hydroxy-2-iodopropan-1-one |
| SMILES | CC(O)(I)C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H7Cl2IO2/c1-9(12,14)8(13)6-3-2-5(10)4-7(6)11/h2-4,14H,1H3 |
| InChIKey | OISHJILTWWYPET-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.96 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|