C8H3Cl3F2O — CID 130477601
2-chloro-1-(2,4-dichlorophenyl)-2,2-difluoroethanone (PubChem CID 130477601) has the molecular formula C8H3Cl3F2O and a molecular weight of 259.47 g/mol. Its IUPAC name is 2-chloro-1-(2,4-dichlorophenyl)-2,2-difluoroethanone.
| Compound Name | 2-chloro-1-(2,4-dichlorophenyl)-2,2-difluoroethanone |
|---|---|
| PubChem CID | 130477601 |
| Molecular Formula | C8H3Cl3F2O |
| Molecular Weight | 259.47 g/mol |
| Exact Mass | 257.92 |
| IUPAC Name | 2-chloro-1-(2,4-dichlorophenyl)-2,2-difluoroethanone |
| SMILES | O=C(c1ccc(Cl)cc1Cl)C(F)(F)Cl |
| InChI | InChI=1S/C8H3Cl3F2O/c9-4-1-2-5(6(10)3-4)7(14)8(11,12)13/h1-3H |
| InChIKey | NKENCNWOHRCZMF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|