C10H9Cl3O3S — CID 102549756
2-chloro-1-(2,4-dichlorophenyl)-2-methylsulfonylpropan-1-one (PubChem CID 102549756) has the molecular formula C10H9Cl3O3S and a molecular weight of 315.61 g/mol. Its IUPAC name is 2-chloro-1-(2,4-dichlorophenyl)-2-methylsulfonylpropan-1-one.
| Compound Name | 2-chloro-1-(2,4-dichlorophenyl)-2-methylsulfonylpropan-1-one |
|---|---|
| PubChem CID | 102549756 |
| Molecular Formula | C10H9Cl3O3S |
| Molecular Weight | 315.61 g/mol |
| Exact Mass | 313.93 |
| IUPAC Name | 2-chloro-1-(2,4-dichlorophenyl)-2-methylsulfonylpropan-1-one |
| SMILES | CC(Cl)(C(=O)c1ccc(Cl)cc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C10H9Cl3O3S/c1-10(13,17(2,15)16)9(14)7-4-3-6(11)5-8(7)12/h3-5H,1-2H3 |
| InChIKey | CUKNQAQOFLANQZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.61 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|