C8H5Cl2NO — CID 70837657
2,4-dichloro-N-methylidenebenzamide (PubChem CID 70837657) has the molecular formula C8H5Cl2NO and a molecular weight of 202.04 g/mol. Its IUPAC name is 2,4-dichloro-N-methylidenebenzamide.
| Compound Name | 2,4-dichloro-N-methylidenebenzamide |
|---|---|
| PubChem CID | 70837657 |
| Molecular Formula | C8H5Cl2NO |
| Molecular Weight | 202.04 g/mol |
| Exact Mass | 200.97 |
| IUPAC Name | 2,4-dichloro-N-methylidenebenzamide |
| SMILES | C=NC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H5Cl2NO/c1-11-8(12)6-3-2-5(9)4-7(6)10/h2-4H,1H2 |
| InChIKey | IOEJDKOMSRJRMU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.04 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|