C10H7Cl2O3+ — CID 59753951
[2-(2,4-dichlorophenyl)-2-oxoethyl] acetate (PubChem CID 59753951) has the molecular formula C10H7Cl2O3+ and a molecular weight of 246.07 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-2-oxoethyl] acetate.
| Compound Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 59753951 |
| Molecular Formula | C10H7Cl2O3+ |
| Molecular Weight | 246.07 g/mol |
| Exact Mass | 244.98 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] acetate |
| SMILES | [CH2+]C(=O)OCC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H7Cl2O3/c1-6(13)15-5-10(14)8-3-2-7(11)4-9(8)12/h2-4H,1,5H2/q+1 |
| InChIKey | VKJHEIUIZBIUGT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.07 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|