C14H7BrCl4O2 — CID 107659402
2-(4-bromo-2,5-dichlorophenoxy)-1-(2,4-dichlorophenyl)ethanone (PubChem CID 107659402) has the molecular formula C14H7BrCl4O2 and a molecular weight of 428.92 g/mol. Its IUPAC name is 2-(4-bromo-2,5-dichlorophenoxy)-1-(2,4-dichlorophenyl)ethanone.
| Compound Name | 2-(4-bromo-2,5-dichlorophenoxy)-1-(2,4-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 107659402 |
| Molecular Formula | C14H7BrCl4O2 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 425.84 |
| IUPAC Name | 2-(4-bromo-2,5-dichlorophenoxy)-1-(2,4-dichlorophenyl)ethanone |
| SMILES | O=C(COc1cc(Cl)c(Br)cc1Cl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H7BrCl4O2/c15-9-4-12(19)14(5-11(9)18)21-6-13(20)8-2-1-7(16)3-10(8)17/h1-5H,6H2 |
| InChIKey | HPXYWIGVAZQPIQ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|