C10H7BrCl2O3 — CID 107654981
2-[(4-bromo-2,5-dichlorophenoxy)methyl]prop-2-enoic acid (PubChem CID 107654981) has the molecular formula C10H7BrCl2O3 and a molecular weight of 325.97 g/mol. Its IUPAC name is 2-[(4-bromo-2,5-dichlorophenoxy)methyl]prop-2-enoic acid.
| Compound Name | 2-[(4-bromo-2,5-dichlorophenoxy)methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 107654981 |
| Molecular Formula | C10H7BrCl2O3 |
| Molecular Weight | 325.97 g/mol |
| Exact Mass | 323.90 |
| IUPAC Name | 2-[(4-bromo-2,5-dichlorophenoxy)methyl]prop-2-enoic acid |
| SMILES | C=C(COc1cc(Cl)c(Br)cc1Cl)C(=O)O |
| InChI | InChI=1S/C10H7BrCl2O3/c1-5(10(14)15)4-16-9-3-7(12)6(11)2-8(9)13/h2-3H,1,4H2,(H,14,15) |
| InChIKey | UXEZJXCEYDDEMB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.97 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|