2-[(4-bromo-2,5-dichlorophenoxy)methyl]prop-2-enoic acid

C10H7BrCl2O3 — CID 107654981

IUPAC2-[(4-bromo-2,5-dichlorophenoxy)methyl]prop-2-enoic acid
SMILESC=C(COc1cc(Cl)c(Br)cc1Cl)C(=O)O
InChIInChI=1S/C10H7BrCl2O3/c1-5(10(14)15)4-16-9-3-7(12)6(11)2-8(9)13/h2-3H,1,4H2,(H,14,15)
InChIKeyUXEZJXCEYDDEMB-UHFFFAOYSA-N
MW325.97 g/mol
LogP3.78
Rot. Bonds4

About 2-[(4-bromo-2,5-dichlorophenoxy)methyl]prop-2-enoic acid

2-[(4-bromo-2,5-dichlorophenoxy)methyl]prop-2-enoic acid (PubChem CID 107654981) has the molecular formula C10H7BrCl2O3 and a molecular weight of 325.97 g/mol. Its IUPAC name is 2-[(4-bromo-2,5-dichlorophenoxy)methyl]prop-2-enoic acid.

Molecular Properties

Compound Name2-[(4-bromo-2,5-dichlorophenoxy)methyl]prop-2-enoic acid
PubChem CID107654981
Molecular FormulaC10H7BrCl2O3
Molecular Weight325.97 g/mol
Exact Mass323.90
IUPAC Name2-[(4-bromo-2,5-dichlorophenoxy)methyl]prop-2-enoic acid
SMILESC=C(COc1cc(Cl)c(Br)cc1Cl)C(=O)O
InChIInChI=1S/C10H7BrCl2O3/c1-5(10(14)15)4-16-9-3-7(12)6(11)2-8(9)13/h2-3H,1,4H2,(H,14,15)
InChIKeyUXEZJXCEYDDEMB-UHFFFAOYSA-N
XLogP3.78
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500325.97
LogP ≤ 53.78
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-[(4-bromo-2,5-dichlorophenoxy)methyl]prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(4-bromo-2,5-dichlorophenoxy)methyl]prop-2-enoic acid?
The IUPAC name of 2-[(4-bromo-2,5-dichlorophenoxy)methyl]prop-2-enoic acid (CID 107654981) is 2-[(4-bromo-2,5-dichlorophenoxy)methyl]prop-2-enoic acid.
What is the SMILES notation for 2-[(4-bromo-2,5-dichlorophenoxy)methyl]prop-2-enoic acid?
The canonical SMILES for 2-[(4-bromo-2,5-dichlorophenoxy)methyl]prop-2-enoic acid is C=C(COc1cc(Cl)c(Br)cc1Cl)C(=O)O.
What is the InChIKey of 2-[(4-bromo-2,5-dichlorophenoxy)methyl]prop-2-enoic acid?
The InChIKey is UXEZJXCEYDDEMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrCl2O3/c1-5(10(14)15)4-16-9-3-7(12)6(11)2-8(9)13/h2-3H,1,4H2,(H,14,15).
What are the key properties of 2-[(4-bromo-2,5-dichlorophenoxy)methyl]prop-2-enoic acid?
2-[(4-bromo-2,5-dichlorophenoxy)methyl]prop-2-enoic acid has a molecular weight of 325.97 g/mol, XLogP of 3.78, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-bromo-2,5-dichlorophenoxy)methyl]prop-2-enoic acid is sourced from PubChem (CID 107654981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).