C11H11BrCl2O4 — CID 107654935
methyl 3-(4-bromo-2,5-dichlorophenoxy)-2-hydroxy-2-methylpropanoate (PubChem CID 107654935) has the molecular formula C11H11BrCl2O4 and a molecular weight of 358.02 g/mol. Its IUPAC name is methyl 3-(4-bromo-2,5-dichlorophenoxy)-2-hydroxy-2-methylpropanoate.
| Compound Name | methyl 3-(4-bromo-2,5-dichlorophenoxy)-2-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 107654935 |
| Molecular Formula | C11H11BrCl2O4 |
| Molecular Weight | 358.02 g/mol |
| Exact Mass | 355.92 |
| IUPAC Name | methyl 3-(4-bromo-2,5-dichlorophenoxy)-2-hydroxy-2-methylpropanoate |
| SMILES | COC(=O)C(C)(O)COc1cc(Cl)c(Br)cc1Cl |
| InChI | InChI=1S/C11H11BrCl2O4/c1-11(16,10(15)17-2)5-18-9-4-7(13)6(12)3-8(9)14/h3-4,16H,5H2,1-2H3 |
| InChIKey | HDXSLHROSZQQOO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.02 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|