C11H13BrClNO3 — CID 104644737
methyl 3-(3-bromo-4-chloroanilino)-2-hydroxy-2-methylpropanoate (PubChem CID 104644737) has the molecular formula C11H13BrClNO3 and a molecular weight of 322.59 g/mol. Its IUPAC name is methyl 3-(3-bromo-4-chloroanilino)-2-hydroxy-2-methylpropanoate.
| Compound Name | methyl 3-(3-bromo-4-chloroanilino)-2-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 104644737 |
| Molecular Formula | C11H13BrClNO3 |
| Molecular Weight | 322.59 g/mol |
| Exact Mass | 320.98 |
| IUPAC Name | methyl 3-(3-bromo-4-chloroanilino)-2-hydroxy-2-methylpropanoate |
| SMILES | COC(=O)C(C)(O)CNc1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C11H13BrClNO3/c1-11(16,10(15)17-2)6-14-7-3-4-9(13)8(12)5-7/h3-5,14,16H,6H2,1-2H3 |
| InChIKey | QZTBNVHPESCBHA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.59 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |