C15H23NO5 — CID 104643707
methyl 3-(3,4-diethoxyanilino)-2-hydroxy-2-methylpropanoate (PubChem CID 104643707) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is methyl 3-(3,4-diethoxyanilino)-2-hydroxy-2-methylpropanoate.
| Compound Name | methyl 3-(3,4-diethoxyanilino)-2-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 104643707 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | methyl 3-(3,4-diethoxyanilino)-2-hydroxy-2-methylpropanoate |
| SMILES | CCOc1ccc(NCC(C)(O)C(=O)OC)cc1OCC |
| InChI | InChI=1S/C15H23NO5/c1-5-20-12-8-7-11(9-13(12)21-6-2)16-10-15(3,18)14(17)19-4/h7-9,16,18H,5-6,10H2,1-4H3 |
| InChIKey | BIAQZMTVSUGGBB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|