C12H13ClF3NO3 — CID 104643892
methyl 3-[4-chloro-3-(trifluoromethyl)anilino]-2-hydroxy-2-methylpropanoate (PubChem CID 104643892) has the molecular formula C12H13ClF3NO3 and a molecular weight of 311.69 g/mol. Its IUPAC name is methyl 3-[4-chloro-3-(trifluoromethyl)anilino]-2-hydroxy-2-methylpropanoate.
| Compound Name | methyl 3-[4-chloro-3-(trifluoromethyl)anilino]-2-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 104643892 |
| Molecular Formula | C12H13ClF3NO3 |
| Molecular Weight | 311.69 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | methyl 3-[4-chloro-3-(trifluoromethyl)anilino]-2-hydroxy-2-methylpropanoate |
| SMILES | COC(=O)C(C)(O)CNc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13ClF3NO3/c1-11(19,10(18)20-2)6-17-7-3-4-9(13)8(5-7)12(14,15)16/h3-5,17,19H,6H2,1-2H3 |
| InChIKey | KPJIXCUFHQITRK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.69 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |