C13H16F3NO3 — CID 104644261
methyl 2-hydroxy-2-methyl-3-[4-methyl-3-(trifluoromethyl)anilino]propanoate (PubChem CID 104644261) has the molecular formula C13H16F3NO3 and a molecular weight of 291.27 g/mol. Its IUPAC name is methyl 2-hydroxy-2-methyl-3-[4-methyl-3-(trifluoromethyl)anilino]propanoate.
| Compound Name | methyl 2-hydroxy-2-methyl-3-[4-methyl-3-(trifluoromethyl)anilino]propanoate |
|---|---|
| PubChem CID | 104644261 |
| Molecular Formula | C13H16F3NO3 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | methyl 2-hydroxy-2-methyl-3-[4-methyl-3-(trifluoromethyl)anilino]propanoate |
| SMILES | COC(=O)C(C)(O)CNc1ccc(C)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H16F3NO3/c1-8-4-5-9(6-10(8)13(14,15)16)17-7-12(2,19)11(18)20-3/h4-6,17,19H,7H2,1-3H3 |
| InChIKey | ZILWZCOQKNBEHX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |