C14H17F3N2O — CID 60703975
2-[4-methyl-3-(trifluoromethyl)anilino]-1-pyrrolidin-1-ylethanone (PubChem CID 60703975) has the molecular formula C14H17F3N2O and a molecular weight of 286.30 g/mol. Its IUPAC name is 2-[4-methyl-3-(trifluoromethyl)anilino]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[4-methyl-3-(trifluoromethyl)anilino]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 60703975 |
| Molecular Formula | C14H17F3N2O |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 2-[4-methyl-3-(trifluoromethyl)anilino]-1-pyrrolidin-1-ylethanone |
| SMILES | Cc1ccc(NCC(=O)N2CCCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C14H17F3N2O/c1-10-4-5-11(8-12(10)14(15,16)17)18-9-13(20)19-6-2-3-7-19/h4-5,8,18H,2-3,6-7,9H2,1H3 |
| InChIKey | IZYJKEUTWBRFPI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |