C15H17F4N3O2 — CID 71858061
1-[2-[4-fluoro-3-(trifluoromethyl)anilino]acetyl]piperidine-3-carboxamide (PubChem CID 71858061) has the molecular formula C15H17F4N3O2 and a molecular weight of 347.31 g/mol. Its IUPAC name is 1-[2-[4-fluoro-3-(trifluoromethyl)anilino]acetyl]piperidine-3-carboxamide.
| Compound Name | 1-[2-[4-fluoro-3-(trifluoromethyl)anilino]acetyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 71858061 |
| Molecular Formula | C15H17F4N3O2 |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 1-[2-[4-fluoro-3-(trifluoromethyl)anilino]acetyl]piperidine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(C(=O)CNc2ccc(F)c(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C15H17F4N3O2/c16-12-4-3-10(6-11(12)15(17,18)19)21-7-13(23)22-5-1-2-9(8-22)14(20)24/h3-4,6,9,21H,1-2,5,7-8H2,(H2,20,24) |
| InChIKey | TYIBHKNXMLATCG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |