C15H20ClN3O2 — CID 78821494
1-[2-(2-chloro-4-methylanilino)acetyl]piperidine-3-carboxamide (PubChem CID 78821494) has the molecular formula C15H20ClN3O2 and a molecular weight of 309.80 g/mol. Its IUPAC name is 1-[2-(2-chloro-4-methylanilino)acetyl]piperidine-3-carboxamide.
| Compound Name | 1-[2-(2-chloro-4-methylanilino)acetyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 78821494 |
| Molecular Formula | C15H20ClN3O2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 1-[2-(2-chloro-4-methylanilino)acetyl]piperidine-3-carboxamide |
| SMILES | Cc1ccc(NCC(=O)N2CCCC(C(N)=O)C2)c(Cl)c1 |
| InChI | InChI=1S/C15H20ClN3O2/c1-10-4-5-13(12(16)7-10)18-8-14(20)19-6-2-3-11(9-19)15(17)21/h4-5,7,11,18H,2-3,6,8-9H2,1H3,(H2,17,21) |
| InChIKey | BGKVSMXBRFKEPY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |