C16H21F4N3O3S — CID 95155929
(3S)-1-[3-[[4-fluoro-3-(trifluoromethyl)phenyl]sulfonylamino]propyl]piperidine-3-carboxamide (PubChem CID 95155929) has the molecular formula C16H21F4N3O3S and a molecular weight of 411.42 g/mol. Its IUPAC name is (3S)-1-[3-[[4-fluoro-3-(trifluoromethyl)phenyl]sulfonylamino]propyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-[3-[[4-fluoro-3-(trifluoromethyl)phenyl]sulfonylamino]propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95155929 |
| Molecular Formula | C16H21F4N3O3S |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | (3S)-1-[3-[[4-fluoro-3-(trifluoromethyl)phenyl]sulfonylamino]propyl]piperidine-3-carboxamide |
| SMILES | NC(=O)[C@H]1CCCN(CCCNS(=O)(=O)c2ccc(F)c(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C16H21F4N3O3S/c17-14-5-4-12(9-13(14)16(18,19)20)27(25,26)22-6-2-8-23-7-1-3-11(10-23)15(21)24/h4-5,9,11,22H,1-3,6-8,10H2,(H2,21,24)/t11-/m0/s1 |
| InChIKey | JWDRMFIGJWVHJD-NSHDSACASA-N |
| XLogP | 1.71 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|