C13H18FN3O2S2 — CID 63289015
2-fluoro-5-(2-pyrrolidin-1-ylethylsulfamoyl)benzenecarbothioamide (PubChem CID 63289015) has the molecular formula C13H18FN3O2S2 and a molecular weight of 331.44 g/mol. Its IUPAC name is 2-fluoro-5-(2-pyrrolidin-1-ylethylsulfamoyl)benzenecarbothioamide.
| Compound Name | 2-fluoro-5-(2-pyrrolidin-1-ylethylsulfamoyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 63289015 |
| Molecular Formula | C13H18FN3O2S2 |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 2-fluoro-5-(2-pyrrolidin-1-ylethylsulfamoyl)benzenecarbothioamide |
| SMILES | NC(=S)c1cc(S(=O)(=O)NCCN2CCCC2)ccc1F |
| InChI | InChI=1S/C13H18FN3O2S2/c14-12-4-3-10(9-11(12)13(15)20)21(18,19)16-5-8-17-6-1-2-7-17/h3-4,9,16H,1-2,5-8H2,(H2,15,20) |
| InChIKey | VQAXTISBMSCJSN-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|