C12H12FN3O2S3 — CID 63824301
2-fluoro-5-[2-(1,3-thiazol-4-yl)ethylsulfamoyl]benzenecarbothioamide (PubChem CID 63824301) has the molecular formula C12H12FN3O2S3 and a molecular weight of 345.45 g/mol. Its IUPAC name is 2-fluoro-5-[2-(1,3-thiazol-4-yl)ethylsulfamoyl]benzenecarbothioamide.
| Compound Name | 2-fluoro-5-[2-(1,3-thiazol-4-yl)ethylsulfamoyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 63824301 |
| Molecular Formula | C12H12FN3O2S3 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | 2-fluoro-5-[2-(1,3-thiazol-4-yl)ethylsulfamoyl]benzenecarbothioamide |
| SMILES | NC(=S)c1cc(S(=O)(=O)NCCc2cscn2)ccc1F |
| InChI | InChI=1S/C12H12FN3O2S3/c13-11-2-1-9(5-10(11)12(14)19)21(17,18)16-4-3-8-6-20-7-15-8/h1-2,5-7,16H,3-4H2,(H2,14,19) |
| InChIKey | JJKUOSXLEVBWGL-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|