C11H11FN2O2S2 — CID 63824991
4-fluoro-N-[2-(1,3-thiazol-4-yl)ethyl]benzenesulfonamide (PubChem CID 63824991) has the molecular formula C11H11FN2O2S2 and a molecular weight of 286.35 g/mol. Its IUPAC name is 4-fluoro-N-[2-(1,3-thiazol-4-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[2-(1,3-thiazol-4-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 63824991 |
| Molecular Formula | C11H11FN2O2S2 |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 4-fluoro-N-[2-(1,3-thiazol-4-yl)ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCc1cscn1)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H11FN2O2S2/c12-9-1-3-11(4-2-9)18(15,16)14-6-5-10-7-17-8-13-10/h1-4,7-8,14H,5-6H2 |
| InChIKey | GIJSSESEIDLASL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |