C11H11F2N3O2S2 — CID 63830560
5-amino-2,4-difluoro-N-[2-(1,3-thiazol-4-yl)ethyl]benzenesulfonamide (PubChem CID 63830560) has the molecular formula C11H11F2N3O2S2 and a molecular weight of 319.36 g/mol. Its IUPAC name is 5-amino-2,4-difluoro-N-[2-(1,3-thiazol-4-yl)ethyl]benzenesulfonamide.
| Compound Name | 5-amino-2,4-difluoro-N-[2-(1,3-thiazol-4-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 63830560 |
| Molecular Formula | C11H11F2N3O2S2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 5-amino-2,4-difluoro-N-[2-(1,3-thiazol-4-yl)ethyl]benzenesulfonamide |
| SMILES | Nc1cc(S(=O)(=O)NCCc2cscn2)c(F)cc1F |
| InChI | InChI=1S/C11H11F2N3O2S2/c12-8-3-9(13)11(4-10(8)14)20(17,18)16-2-1-7-5-19-6-15-7/h3-6,16H,1-2,14H2 |
| InChIKey | ISYWAAHYVAUIQZ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|