C11H12N4O4S2 — CID 63823464
2-amino-4-nitro-N-[2-(1,3-thiazol-4-yl)ethyl]benzenesulfonamide (PubChem CID 63823464) has the molecular formula C11H12N4O4S2 and a molecular weight of 328.38 g/mol. Its IUPAC name is 2-amino-4-nitro-N-[2-(1,3-thiazol-4-yl)ethyl]benzenesulfonamide.
| Compound Name | 2-amino-4-nitro-N-[2-(1,3-thiazol-4-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 63823464 |
| Molecular Formula | C11H12N4O4S2 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 2-amino-4-nitro-N-[2-(1,3-thiazol-4-yl)ethyl]benzenesulfonamide |
| SMILES | Nc1cc([N+](=O)[O-])ccc1S(=O)(=O)NCCc1cscn1 |
| InChI | InChI=1S/C11H12N4O4S2/c12-10-5-9(15(16)17)1-2-11(10)21(18,19)14-4-3-8-6-20-7-13-8/h1-2,5-7,14H,3-4,12H2 |
| InChIKey | CYKBNAUZSQWDNJ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|