C13H13N3O2S2 — CID 103717223
4-cyano-2-methyl-N-[2-(1,3-thiazol-4-yl)ethyl]benzenesulfonamide (PubChem CID 103717223) has the molecular formula C13H13N3O2S2 and a molecular weight of 307.40 g/mol. Its IUPAC name is 4-cyano-2-methyl-N-[2-(1,3-thiazol-4-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-cyano-2-methyl-N-[2-(1,3-thiazol-4-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 103717223 |
| Molecular Formula | C13H13N3O2S2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 4-cyano-2-methyl-N-[2-(1,3-thiazol-4-yl)ethyl]benzenesulfonamide |
| SMILES | Cc1cc(C#N)ccc1S(=O)(=O)NCCc1cscn1 |
| InChI | InChI=1S/C13H13N3O2S2/c1-10-6-11(7-14)2-3-13(10)20(17,18)16-5-4-12-8-19-9-15-12/h2-3,6,8-9,16H,4-5H2,1H3 |
| InChIKey | WWHASEVJSVNMCG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |