C11H13ClN2O2S — CID 106998775
N-(3-chloropropyl)-4-cyano-2-methylbenzenesulfonamide (PubChem CID 106998775) has the molecular formula C11H13ClN2O2S and a molecular weight of 272.76 g/mol. Its IUPAC name is N-(3-chloropropyl)-4-cyano-2-methylbenzenesulfonamide.
| Compound Name | N-(3-chloropropyl)-4-cyano-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106998775 |
| Molecular Formula | C11H13ClN2O2S |
| Molecular Weight | 272.76 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | N-(3-chloropropyl)-4-cyano-2-methylbenzenesulfonamide |
| SMILES | Cc1cc(C#N)ccc1S(=O)(=O)NCCCCl |
| InChI | InChI=1S/C11H13ClN2O2S/c1-9-7-10(8-13)3-4-11(9)17(15,16)14-6-2-5-12/h3-4,7,14H,2,5-6H2,1H3 |
| InChIKey | KFSDRLUYLZJRNE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.76 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|