C13H19ClFNO2S — CID 114008823
N-(6-chlorohexyl)-4-fluoro-2-methylbenzenesulfonamide (PubChem CID 114008823) has the molecular formula C13H19ClFNO2S and a molecular weight of 307.82 g/mol. Its IUPAC name is N-(6-chlorohexyl)-4-fluoro-2-methylbenzenesulfonamide.
| Compound Name | N-(6-chlorohexyl)-4-fluoro-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 114008823 |
| Molecular Formula | C13H19ClFNO2S |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | N-(6-chlorohexyl)-4-fluoro-2-methylbenzenesulfonamide |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)NCCCCCCCl |
| InChI | InChI=1S/C13H19ClFNO2S/c1-11-10-12(15)6-7-13(11)19(17,18)16-9-5-3-2-4-8-14/h6-7,10,16H,2-5,8-9H2,1H3 |
| InChIKey | ODIDAKJRLHSWKL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|