C15H16FNO3S — CID 35609122
4-fluoro-2-methyl-N-(2-phenoxyethyl)benzenesulfonamide (PubChem CID 35609122) has the molecular formula C15H16FNO3S and a molecular weight of 309.36 g/mol. Its IUPAC name is 4-fluoro-2-methyl-N-(2-phenoxyethyl)benzenesulfonamide.
| Compound Name | 4-fluoro-2-methyl-N-(2-phenoxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 35609122 |
| Molecular Formula | C15H16FNO3S |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 4-fluoro-2-methyl-N-(2-phenoxyethyl)benzenesulfonamide |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)NCCOc1ccccc1 |
| InChI | InChI=1S/C15H16FNO3S/c1-12-11-13(16)7-8-15(12)21(18,19)17-9-10-20-14-5-3-2-4-6-14/h2-8,11,17H,9-10H2,1H3 |
| InChIKey | RIBOLZNGEAJSMF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|