C15H15F2NO4S — CID 110758295
2,4-difluoro-N-[2-(4-methoxyphenoxy)ethyl]benzenesulfonamide (PubChem CID 110758295) has the molecular formula C15H15F2NO4S and a molecular weight of 343.35 g/mol. Its IUPAC name is 2,4-difluoro-N-[2-(4-methoxyphenoxy)ethyl]benzenesulfonamide.
| Compound Name | 2,4-difluoro-N-[2-(4-methoxyphenoxy)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110758295 |
| Molecular Formula | C15H15F2NO4S |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 2,4-difluoro-N-[2-(4-methoxyphenoxy)ethyl]benzenesulfonamide |
| SMILES | COc1ccc(OCCNS(=O)(=O)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C15H15F2NO4S/c1-21-12-3-5-13(6-4-12)22-9-8-18-23(19,20)15-7-2-11(16)10-14(15)17/h2-7,10,18H,8-9H2,1H3 |
| InChIKey | DHRAKMLSPXMKFN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|