C18H23NO7S — CID 113102102
N-[2-(3,5-dimethoxyphenoxy)ethyl]-2,4-dimethoxybenzenesulfonamide (PubChem CID 113102102) has the molecular formula C18H23NO7S and a molecular weight of 397.45 g/mol. Its IUPAC name is N-[2-(3,5-dimethoxyphenoxy)ethyl]-2,4-dimethoxybenzenesulfonamide.
| Compound Name | N-[2-(3,5-dimethoxyphenoxy)ethyl]-2,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 113102102 |
| Molecular Formula | C18H23NO7S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | N-[2-(3,5-dimethoxyphenoxy)ethyl]-2,4-dimethoxybenzenesulfonamide |
| SMILES | COc1cc(OC)cc(OCCNS(=O)(=O)c2ccc(OC)cc2OC)c1 |
| InChI | InChI=1S/C18H23NO7S/c1-22-13-5-6-18(17(12-13)25-4)27(20,21)19-7-8-26-16-10-14(23-2)9-15(11-16)24-3/h5-6,9-12,19H,7-8H2,1-4H3 |
| InChIKey | DDJQEHQIHKDHTI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|