C19H25NO4S — CID 30365956
N-[2-(3,5-dimethylphenoxy)ethyl]-2-methoxy-4,5-dimethylbenzenesulfonamide (PubChem CID 30365956) has the molecular formula C19H25NO4S and a molecular weight of 363.48 g/mol. Its IUPAC name is N-[2-(3,5-dimethylphenoxy)ethyl]-2-methoxy-4,5-dimethylbenzenesulfonamide.
| Compound Name | N-[2-(3,5-dimethylphenoxy)ethyl]-2-methoxy-4,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 30365956 |
| Molecular Formula | C19H25NO4S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | N-[2-(3,5-dimethylphenoxy)ethyl]-2-methoxy-4,5-dimethylbenzenesulfonamide |
| SMILES | COc1cc(C)c(C)cc1S(=O)(=O)NCCOc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C19H25NO4S/c1-13-8-14(2)10-17(9-13)24-7-6-20-25(21,22)19-12-16(4)15(3)11-18(19)23-5/h8-12,20H,6-7H2,1-5H3 |
| InChIKey | CLMPTXNDYCGCQJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|