C16H19NO3S — CID 30365872
N-[2-(3,5-dimethylphenoxy)ethyl]benzenesulfonamide (PubChem CID 30365872) has the molecular formula C16H19NO3S and a molecular weight of 305.40 g/mol. Its IUPAC name is N-[2-(3,5-dimethylphenoxy)ethyl]benzenesulfonamide.
| Compound Name | N-[2-(3,5-dimethylphenoxy)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 30365872 |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | N-[2-(3,5-dimethylphenoxy)ethyl]benzenesulfonamide |
| SMILES | Cc1cc(C)cc(OCCNS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C16H19NO3S/c1-13-10-14(2)12-15(11-13)20-9-8-17-21(18,19)16-6-4-3-5-7-16/h3-7,10-12,17H,8-9H2,1-2H3 |
| InChIKey | ZCUFEIURPPWWLC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|