C15H19NO3S2 — CID 30365965
N-[2-(3,5-dimethylphenoxy)ethyl]-5-methylthiophene-2-sulfonamide (PubChem CID 30365965) has the molecular formula C15H19NO3S2 and a molecular weight of 325.46 g/mol. Its IUPAC name is N-[2-(3,5-dimethylphenoxy)ethyl]-5-methylthiophene-2-sulfonamide.
| Compound Name | N-[2-(3,5-dimethylphenoxy)ethyl]-5-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 30365965 |
| Molecular Formula | C15H19NO3S2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | N-[2-(3,5-dimethylphenoxy)ethyl]-5-methylthiophene-2-sulfonamide |
| SMILES | Cc1cc(C)cc(OCCNS(=O)(=O)c2ccc(C)s2)c1 |
| InChI | InChI=1S/C15H19NO3S2/c1-11-8-12(2)10-14(9-11)19-7-6-16-21(17,18)15-5-4-13(3)20-15/h4-5,8-10,16H,6-7H2,1-3H3 |
| InChIKey | JBYBLMLEOWMISW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|