C16H18FNO3S — CID 30365901
N-[2-(3,5-dimethylphenoxy)ethyl]-3-fluorobenzenesulfonamide (PubChem CID 30365901) has the molecular formula C16H18FNO3S and a molecular weight of 323.39 g/mol. Its IUPAC name is N-[2-(3,5-dimethylphenoxy)ethyl]-3-fluorobenzenesulfonamide.
| Compound Name | N-[2-(3,5-dimethylphenoxy)ethyl]-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 30365901 |
| Molecular Formula | C16H18FNO3S |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | N-[2-(3,5-dimethylphenoxy)ethyl]-3-fluorobenzenesulfonamide |
| SMILES | Cc1cc(C)cc(OCCNS(=O)(=O)c2cccc(F)c2)c1 |
| InChI | InChI=1S/C16H18FNO3S/c1-12-8-13(2)10-15(9-12)21-7-6-18-22(19,20)16-5-3-4-14(17)11-16/h3-5,8-11,18H,6-7H2,1-2H3 |
| InChIKey | ZHRYAPQMTKAAFF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|