C17H21NO6S — CID 8990569
3,4,5-trimethoxy-N-(2-phenoxyethyl)benzenesulfonamide (PubChem CID 8990569) has the molecular formula C17H21NO6S and a molecular weight of 367.42 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-(2-phenoxyethyl)benzenesulfonamide.
| Compound Name | 3,4,5-trimethoxy-N-(2-phenoxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 8990569 |
| Molecular Formula | C17H21NO6S |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 3,4,5-trimethoxy-N-(2-phenoxyethyl)benzenesulfonamide |
| SMILES | COc1cc(S(=O)(=O)NCCOc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C17H21NO6S/c1-21-15-11-14(12-16(22-2)17(15)23-3)25(19,20)18-9-10-24-13-7-5-4-6-8-13/h4-8,11-12,18H,9-10H2,1-3H3 |
| InChIKey | LKWBGPUENGGMLI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|