C20H26O5 — CID 141201011
1,2,3-trimethoxy-5-(5-phenoxypentoxy)benzene (PubChem CID 141201011) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is 1,2,3-trimethoxy-5-(5-phenoxypentoxy)benzene.
| Compound Name | 1,2,3-trimethoxy-5-(5-phenoxypentoxy)benzene |
|---|---|
| PubChem CID | 141201011 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 1,2,3-trimethoxy-5-(5-phenoxypentoxy)benzene |
| SMILES | COc1cc(OCCCCCOc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C20H26O5/c1-21-18-14-17(15-19(22-2)20(18)23-3)25-13-9-5-8-12-24-16-10-6-4-7-11-16/h4,6-7,10-11,14-15H,5,8-9,12-13H2,1-3H3 |
| InChIKey | WUJKRHJNSBKQMR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|