C42H44O5P+ — CID 171151855
6-[4-[3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]phenoxy]hexyl-triphenylphosphanium (PubChem CID 171151855) has the molecular formula C42H44O5P+ and a molecular weight of 659.78 g/mol. Its IUPAC name is 6-[4-[3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]phenoxy]hexyl-triphenylphosphanium.
| Compound Name | 6-[4-[3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]phenoxy]hexyl-triphenylphosphanium |
|---|---|
| PubChem CID | 171151855 |
| Molecular Formula | C42H44O5P+ |
| Molecular Weight | 659.78 g/mol |
| Exact Mass | 659.29 |
| IUPAC Name | 6-[4-[3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]phenoxy]hexyl-triphenylphosphanium |
| SMILES | COc1cc(C(=O)C=Cc2ccc(OCCCCCC[P+](c3ccccc3)(c3ccccc3)c3ccccc3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C42H44O5P/c1-44-40-31-34(32-41(45-2)42(40)46-3)39(43)28-25-33-23-26-35(27-24-33)47-29-15-4-5-16-30-48(36-17-9-6-10-18-36,37-19-11-7-12-20-37)38-21-13-8-14-22-38/h6-14,17-28,31-32H,4-5,15-16,29-30H2,1-3H3/q+1 |
| InChIKey | XNGWTYXKMUTHTE-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.78 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|