C61H56O4P2+2 — CID 121296324
3-[4-[(1E,6E)-3,5-dioxo-7-[4-(3-triphenylphosphaniumylpropoxy)phenyl]hepta-1,6-dienyl]phenoxy]propyl-triphenylphosphanium (PubChem CID 121296324) has the molecular formula C61H56O4P2+2 and a molecular weight of 915.06 g/mol. Its IUPAC name is 3-[4-[(1E,6E)-3,5-dioxo-7-[4-(3-triphenylphosphaniumylpropoxy)phenyl]hepta-1,6-dienyl]phenoxy]propyl-triphenylphosphanium.
| Compound Name | 3-[4-[(1E,6E)-3,5-dioxo-7-[4-(3-triphenylphosphaniumylpropoxy)phenyl]hepta-1,6-dienyl]phenoxy]propyl-triphenylphosphanium |
|---|---|
| PubChem CID | 121296324 |
| Molecular Formula | C61H56O4P2+2 |
| Molecular Weight | 915.06 g/mol |
| Exact Mass | 914.36 |
| IUPAC Name | 3-[4-[(1E,6E)-3,5-dioxo-7-[4-(3-triphenylphosphaniumylpropoxy)phenyl]hepta-1,6-dienyl]phenoxy]propyl-triphenylphosphanium |
| SMILES | O=C(/C=C/c1ccc(OCCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1)CC(=O)/C=C/c1ccc(OCCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C61H56O4P2/c62-52(39-33-50-35-41-54(42-36-50)64-45-19-47-66(56-21-7-1-8-22-56,57-23-9-2-10-24-57)58-25-11-3-12-26-58)49-53(63)40-34-51-37-43-55(44-38-51)65-46-20-48-67(59-27-13-4-14-28-59,60-29-15-5-16-30-60)61-31-17-6-18-32-61/h1-18,21-44H,19-20,45-49H2/q+2/b39-33+,40-34+ |
| InChIKey | LGGXAPVDKVCWRW-CFTRLRGZSA-N |
| XLogP | 11.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.06 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|